C12H16F3NO3 — CID 124833727
(2S,3aR,7aR)-1-(3,3,3-trifluoropropanoyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid (PubChem CID 124833727) has the molecular formula C12H16F3NO3 and a molecular weight of 279.26 g/mol. Its IUPAC name is (2S,3aR,7aR)-1-(3,3,3-trifluoropropanoyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid.
| Compound Name | (2S,3aR,7aR)-1-(3,3,3-trifluoropropanoyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 124833727 |
| Molecular Formula | C12H16F3NO3 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | (2S,3aR,7aR)-1-(3,3,3-trifluoropropanoyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1C[C@H]2CCCC[C@H]2N1C(=O)CC(F)(F)F |
| InChI | InChI=1S/C12H16F3NO3/c13-12(14,15)6-10(17)16-8-4-2-1-3-7(8)5-9(16)11(18)19/h7-9H,1-6H2,(H,18,19)/t7-,8-,9+/m1/s1 |
| InChIKey | WRGRGCHVFNVGRG-HLTSFMKQSA-N |
| XLogP | 2.18 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |