C12H15ClF3NO2 — CID 104700660
1-[2-(2-chloroacetyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-2,2,2-trifluoroethanone (PubChem CID 104700660) has the molecular formula C12H15ClF3NO2 and a molecular weight of 297.70 g/mol. Its IUPAC name is 1-[2-(2-chloroacetyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[2-(2-chloroacetyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 104700660 |
| Molecular Formula | C12H15ClF3NO2 |
| Molecular Weight | 297.70 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 1-[2-(2-chloroacetyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-2,2,2-trifluoroethanone |
| SMILES | O=C(CCl)C1CC2CCCCC2N1C(=O)C(F)(F)F |
| InChI | InChI=1S/C12H15ClF3NO2/c13-6-10(18)9-5-7-3-1-2-4-8(7)17(9)11(19)12(14,15)16/h7-9H,1-6H2 |
| InChIKey | NUFHQXVCWWUNBC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.70 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|