C13H19F3N2O3 — CID 124833553
(2S,3aR,7aR)-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid (PubChem CID 124833553) has the molecular formula C13H19F3N2O3 and a molecular weight of 308.30 g/mol. Its IUPAC name is (2S,3aR,7aR)-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid.
| Compound Name | (2S,3aR,7aR)-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 124833553 |
| Molecular Formula | C13H19F3N2O3 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | (2S,3aR,7aR)-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
| SMILES | O=C(CN1[C@@H]2CCCC[C@@H]2C[C@H]1C(=O)O)NCC(F)(F)F |
| InChI | InChI=1S/C13H19F3N2O3/c14-13(15,16)7-17-11(19)6-18-9-4-2-1-3-8(9)5-10(18)12(20)21/h8-10H,1-7H2,(H,17,19)(H,20,21)/t8-,9-,10+/m1/s1 |
| InChIKey | HPBSLHIJACDDLD-BBBLOLIVSA-N |
| XLogP | 1.38 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |