C18H23FN2O3 — CID 125144172
(2S,3aR,7aR)-1-[2-[(2-fluorophenyl)methylamino]-2-oxoethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid (PubChem CID 125144172) has the molecular formula C18H23FN2O3 and a molecular weight of 334.39 g/mol. Its IUPAC name is (2S,3aR,7aR)-1-[2-[(2-fluorophenyl)methylamino]-2-oxoethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid.
| Compound Name | (2S,3aR,7aR)-1-[2-[(2-fluorophenyl)methylamino]-2-oxoethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 125144172 |
| Molecular Formula | C18H23FN2O3 |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | (2S,3aR,7aR)-1-[2-[(2-fluorophenyl)methylamino]-2-oxoethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
| SMILES | O=C(CN1[C@@H]2CCCC[C@@H]2C[C@H]1C(=O)O)NCc1ccccc1F |
| InChI | InChI=1S/C18H23FN2O3/c19-14-7-3-1-6-13(14)10-20-17(22)11-21-15-8-4-2-5-12(15)9-16(21)18(23)24/h1,3,6-7,12,15-16H,2,4-5,8-11H2,(H,20,22)(H,23,24)/t12-,15-,16+/m1/s1 |
| InChIKey | ZOJQICCZAZPPCZ-WQVCFCJDSA-N |
| XLogP | 2.16 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |