C20H25N3O4 — CID 124688376
3-[(3S)-1-[3-(2-methoxyphenyl)-1-methylpyrazole-4-carbonyl]piperidin-3-yl]propanoic acid (PubChem CID 124688376) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is 3-[(3S)-1-[3-(2-methoxyphenyl)-1-methylpyrazole-4-carbonyl]piperidin-3-yl]propanoic acid.
| Compound Name | 3-[(3S)-1-[3-(2-methoxyphenyl)-1-methylpyrazole-4-carbonyl]piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 124688376 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 3-[(3S)-1-[3-(2-methoxyphenyl)-1-methylpyrazole-4-carbonyl]piperidin-3-yl]propanoic acid |
| SMILES | COc1ccccc1-c1nn(C)cc1C(=O)N1CCC[C@@H](CCC(=O)O)C1 |
| InChI | InChI=1S/C20H25N3O4/c1-22-13-16(19(21-22)15-7-3-4-8-17(15)27-2)20(26)23-11-5-6-14(12-23)9-10-18(24)25/h3-4,7-8,13-14H,5-6,9-12H2,1-2H3,(H,24,25)/t14-/m0/s1 |
| InChIKey | SEWIWGHRLKVLEW-AWEZNQCLSA-N |
| XLogP | 2.81 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |