C19H22ClN3O3 — CID 124697243
3-[(3R)-1-[1-(4-chlorophenyl)-3-methylpyrazole-4-carbonyl]piperidin-3-yl]propanoic acid (PubChem CID 124697243) has the molecular formula C19H22ClN3O3 and a molecular weight of 375.86 g/mol. Its IUPAC name is 3-[(3R)-1-[1-(4-chlorophenyl)-3-methylpyrazole-4-carbonyl]piperidin-3-yl]propanoic acid.
| Compound Name | 3-[(3R)-1-[1-(4-chlorophenyl)-3-methylpyrazole-4-carbonyl]piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 124697243 |
| Molecular Formula | C19H22ClN3O3 |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 3-[(3R)-1-[1-(4-chlorophenyl)-3-methylpyrazole-4-carbonyl]piperidin-3-yl]propanoic acid |
| SMILES | Cc1nn(-c2ccc(Cl)cc2)cc1C(=O)N1CCC[C@H](CCC(=O)O)C1 |
| InChI | InChI=1S/C19H22ClN3O3/c1-13-17(12-23(21-13)16-7-5-15(20)6-8-16)19(26)22-10-2-3-14(11-22)4-9-18(24)25/h5-8,12,14H,2-4,9-11H2,1H3,(H,24,25)/t14-/m1/s1 |
| InChIKey | XZDOESVNYURKKN-CQSZACIVSA-N |
| XLogP | 3.55 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |