C15H17ClN4O — CID 119411305
[(3R)-3-aminopyrrolidin-1-yl]-[1-(4-chlorophenyl)-3-methylpyrazol-4-yl]methanone (PubChem CID 119411305) has the molecular formula C15H17ClN4O and a molecular weight of 304.78 g/mol. Its IUPAC name is [(3R)-3-aminopyrrolidin-1-yl]-[1-(4-chlorophenyl)-3-methylpyrazol-4-yl]methanone.
| Compound Name | [(3R)-3-aminopyrrolidin-1-yl]-[1-(4-chlorophenyl)-3-methylpyrazol-4-yl]methanone |
|---|---|
| PubChem CID | 119411305 |
| Molecular Formula | C15H17ClN4O |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | [(3R)-3-aminopyrrolidin-1-yl]-[1-(4-chlorophenyl)-3-methylpyrazol-4-yl]methanone |
| SMILES | Cc1nn(-c2ccc(Cl)cc2)cc1C(=O)N1CC[C@@H](N)C1 |
| InChI | InChI=1S/C15H17ClN4O/c1-10-14(15(21)19-7-6-12(17)8-19)9-20(18-10)13-4-2-11(16)3-5-13/h2-5,9,12H,6-8,17H2,1H3/t12-/m1/s1 |
| InChIKey | YPQIUAUBJRCOMA-GFCCVEGCSA-N |
| XLogP | 2.01 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |