C18H28N2O2 — CID 124691222
1-[(2R,4S)-4-amino-2-methylpiperidin-1-yl]-5-(3-methylphenoxy)pentan-1-one (PubChem CID 124691222) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is 1-[(2R,4S)-4-amino-2-methylpiperidin-1-yl]-5-(3-methylphenoxy)pentan-1-one.
| Compound Name | 1-[(2R,4S)-4-amino-2-methylpiperidin-1-yl]-5-(3-methylphenoxy)pentan-1-one |
|---|---|
| PubChem CID | 124691222 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 1-[(2R,4S)-4-amino-2-methylpiperidin-1-yl]-5-(3-methylphenoxy)pentan-1-one |
| SMILES | Cc1cccc(OCCCCC(=O)N2CC[C@H](N)C[C@H]2C)c1 |
| InChI | InChI=1S/C18H28N2O2/c1-14-6-5-7-17(12-14)22-11-4-3-8-18(21)20-10-9-16(19)13-15(20)2/h5-7,12,15-16H,3-4,8-11,13,19H2,1-2H3/t15-,16+/m1/s1 |
| InChIKey | OYCSUMAZIYQOEQ-CVEARBPZSA-N |
| XLogP | 2.88 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|