About 1-[(2R,4S)-4-amino-2-methylpiperidin-1-yl]-3-(3-bromophenyl)propan-1-one
1-[(2R,4S)-4-amino-2-methylpiperidin-1-yl]-3-(3-bromophenyl)propan-1-one (PubChem CID 124691321) has the molecular formula C15H21BrN2O
and a molecular weight of 325.25 g/mol. Its IUPAC name is 1-[(2R,4S)-4-amino-2-methylpiperidin-1-yl]-3-(3-bromophenyl)propan-1-one.
Molecular Properties
| Compound Name | 1-[(2R,4S)-4-amino-2-methylpiperidin-1-yl]-3-(3-bromophenyl)propan-1-one |
| PubChem CID | 124691321 |
| Molecular Formula | C15H21BrN2O |
| Molecular Weight | 325.25 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 1-[(2R,4S)-4-amino-2-methylpiperidin-1-yl]-3-(3-bromophenyl)propan-1-one |
| SMILES | C[C@@H]1C[C@@H](N)CCN1C(=O)CCc1cccc(Br)c1 |
| InChI | InChI=1S/C15H21BrN2O/c1-11-9-14(17)7-8-18(11)15(19)6-5-12-3-2-4-13(16)10-12/h2-4,10-11,14H,5-9,17H2,1H3/t11-,14+/m1/s1 |
| InChIKey | SZYQUVWTXUYNEB-RISCZKNCSA-N |
| XLogP | 2.72 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.25 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(2R,4S)-4-amino-2-methylpiperidin-1-yl]-3-(3-bromophenyl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2R,4S)-4-amino-2-methylpiperidin-1-yl]-3-(3-bromophenyl)propan-1-one?
The IUPAC name of 1-[(2R,4S)-4-amino-2-methylpiperidin-1-yl]-3-(3-bromophenyl)propan-1-one (CID 124691321) is 1-[(2R,4S)-4-amino-2-methylpiperidin-1-yl]-3-(3-bromophenyl)propan-1-one.
What is the SMILES notation for 1-[(2R,4S)-4-amino-2-methylpiperidin-1-yl]-3-(3-bromophenyl)propan-1-one?
The canonical SMILES for 1-[(2R,4S)-4-amino-2-methylpiperidin-1-yl]-3-(3-bromophenyl)propan-1-one is C[C@@H]1C[C@@H](N)CCN1C(=O)CCc1cccc(Br)c1.
What is the InChIKey of 1-[(2R,4S)-4-amino-2-methylpiperidin-1-yl]-3-(3-bromophenyl)propan-1-one?
The InChIKey is SZYQUVWTXUYNEB-RISCZKNCSA-N. The full InChI is InChI=1S/C15H21BrN2O/c1-11-9-14(17)7-8-18(11)15(19)6-5-12-3-2-4-13(16)10-12/h2-4,10-11,14H,5-9,17H2,1H3/t11-,14+/m1/s1.
What are the key properties of 1-[(2R,4S)-4-amino-2-methylpiperidin-1-yl]-3-(3-bromophenyl)propan-1-one?
1-[(2R,4S)-4-amino-2-methylpiperidin-1-yl]-3-(3-bromophenyl)propan-1-one has a molecular weight of 325.25 g/mol, XLogP of 2.72, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2R,4S)-4-amino-2-methylpiperidin-1-yl]-3-(3-bromophenyl)propan-1-one is sourced from PubChem (CID 124691321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).