C17H25BrN2O — CID 124691223
1-[(2R,4S)-4-amino-2-methylpiperidin-1-yl]-5-(4-bromophenyl)pentan-1-one (PubChem CID 124691223) has the molecular formula C17H25BrN2O and a molecular weight of 353.30 g/mol. Its IUPAC name is 1-[(2R,4S)-4-amino-2-methylpiperidin-1-yl]-5-(4-bromophenyl)pentan-1-one.
| Compound Name | 1-[(2R,4S)-4-amino-2-methylpiperidin-1-yl]-5-(4-bromophenyl)pentan-1-one |
|---|---|
| PubChem CID | 124691223 |
| Molecular Formula | C17H25BrN2O |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 1-[(2R,4S)-4-amino-2-methylpiperidin-1-yl]-5-(4-bromophenyl)pentan-1-one |
| SMILES | C[C@@H]1C[C@@H](N)CCN1C(=O)CCCCc1ccc(Br)cc1 |
| InChI | InChI=1S/C17H25BrN2O/c1-13-12-16(19)10-11-20(13)17(21)5-3-2-4-14-6-8-15(18)9-7-14/h6-9,13,16H,2-5,10-12,19H2,1H3/t13-,16+/m1/s1 |
| InChIKey | QHLABEBVDIVDPB-CJNGLKHVSA-N |
| XLogP | 3.50 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|