C19H26N2O4 — CID 124691395
4-methyl-4-[[(3S)-5-oxo-1-[(1S)-1-phenylethyl]pyrrolidine-3-carbonyl]amino]pentanoic acid (PubChem CID 124691395) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is 4-methyl-4-[[(3S)-5-oxo-1-[(1S)-1-phenylethyl]pyrrolidine-3-carbonyl]amino]pentanoic acid.
| Compound Name | 4-methyl-4-[[(3S)-5-oxo-1-[(1S)-1-phenylethyl]pyrrolidine-3-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 124691395 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 4-methyl-4-[[(3S)-5-oxo-1-[(1S)-1-phenylethyl]pyrrolidine-3-carbonyl]amino]pentanoic acid |
| SMILES | C[C@@H](c1ccccc1)N1C[C@@H](C(=O)NC(C)(C)CCC(=O)O)CC1=O |
| InChI | InChI=1S/C19H26N2O4/c1-13(14-7-5-4-6-8-14)21-12-15(11-16(21)22)18(25)20-19(2,3)10-9-17(23)24/h4-8,13,15H,9-12H2,1-3H3,(H,20,25)(H,23,24)/t13-,15-/m0/s1 |
| InChIKey | LAYAKINYEGQMEZ-ZFWWWQNUSA-N |
| XLogP | 2.36 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |