About (2R)-3-[[(1R,2S)-2-(2-chlorophenyl)cyclopropanecarbonyl]-methylamino]-2-methylpropanoic acid
(2R)-3-[[(1R,2S)-2-(2-chlorophenyl)cyclopropanecarbonyl]-methylamino]-2-methylpropanoic acid (PubChem CID 124693260) has the molecular formula C15H18ClNO3
and a molecular weight of 295.77 g/mol. Its IUPAC name is (2R)-3-[[(1R,2S)-2-(2-chlorophenyl)cyclopropanecarbonyl]-methylamino]-2-methylpropanoic acid.
Molecular Properties
| Compound Name | (2R)-3-[[(1R,2S)-2-(2-chlorophenyl)cyclopropanecarbonyl]-methylamino]-2-methylpropanoic acid |
| PubChem CID | 124693260 |
| Molecular Formula | C15H18ClNO3 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | (2R)-3-[[(1R,2S)-2-(2-chlorophenyl)cyclopropanecarbonyl]-methylamino]-2-methylpropanoic acid |
| SMILES | C[C@H](CN(C)C(=O)[C@@H]1C[C@@H]1c1ccccc1Cl)C(=O)O |
| InChI | InChI=1S/C15H18ClNO3/c1-9(15(19)20)8-17(2)14(18)12-7-11(12)10-5-3-4-6-13(10)16/h3-6,9,11-12H,7-8H2,1-2H3,(H,19,20)/t9-,11-,12-/m1/s1 |
| InChIKey | AXBQFCILQZAJHF-YUSALJHKSA-N |
| XLogP | 2.62 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-3-[[(1R,2S)-2-(2-chlorophenyl)cyclopropanecarbonyl]-methylamino]-2-methylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-3-[[(1R,2S)-2-(2-chlorophenyl)cyclopropanecarbonyl]-methylamino]-2-methylpropanoic acid?
The IUPAC name of (2R)-3-[[(1R,2S)-2-(2-chlorophenyl)cyclopropanecarbonyl]-methylamino]-2-methylpropanoic acid (CID 124693260) is (2R)-3-[[(1R,2S)-2-(2-chlorophenyl)cyclopropanecarbonyl]-methylamino]-2-methylpropanoic acid.
What is the SMILES notation for (2R)-3-[[(1R,2S)-2-(2-chlorophenyl)cyclopropanecarbonyl]-methylamino]-2-methylpropanoic acid?
The canonical SMILES for (2R)-3-[[(1R,2S)-2-(2-chlorophenyl)cyclopropanecarbonyl]-methylamino]-2-methylpropanoic acid is C[C@H](CN(C)C(=O)[C@@H]1C[C@@H]1c1ccccc1Cl)C(=O)O.
What is the InChIKey of (2R)-3-[[(1R,2S)-2-(2-chlorophenyl)cyclopropanecarbonyl]-methylamino]-2-methylpropanoic acid?
The InChIKey is AXBQFCILQZAJHF-YUSALJHKSA-N. The full InChI is InChI=1S/C15H18ClNO3/c1-9(15(19)20)8-17(2)14(18)12-7-11(12)10-5-3-4-6-13(10)16/h3-6,9,11-12H,7-8H2,1-2H3,(H,19,20)/t9-,11-,12-/m1/s1.
What are the key properties of (2R)-3-[[(1R,2S)-2-(2-chlorophenyl)cyclopropanecarbonyl]-methylamino]-2-methylpropanoic acid?
(2R)-3-[[(1R,2S)-2-(2-chlorophenyl)cyclopropanecarbonyl]-methylamino]-2-methylpropanoic acid has a molecular weight of 295.77 g/mol, XLogP of 2.62, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3-[[(1R,2S)-2-(2-chlorophenyl)cyclopropanecarbonyl]-methylamino]-2-methylpropanoic acid is sourced from PubChem (CID 124693260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).