C16H20ClNO3 — CID 119188260
2-[[2-(2-chlorophenyl)cyclopropanecarbonyl]amino]-4-methylpentanoic acid (PubChem CID 119188260) has the molecular formula C16H20ClNO3 and a molecular weight of 309.79 g/mol. Its IUPAC name is 2-[[2-(2-chlorophenyl)cyclopropanecarbonyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[2-(2-chlorophenyl)cyclopropanecarbonyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119188260 |
| Molecular Formula | C16H20ClNO3 |
| Molecular Weight | 309.79 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 2-[[2-(2-chlorophenyl)cyclopropanecarbonyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NC(=O)C1CC1c1ccccc1Cl)C(=O)O |
| InChI | InChI=1S/C16H20ClNO3/c1-9(2)7-14(16(20)21)18-15(19)12-8-11(12)10-5-3-4-6-13(10)17/h3-6,9,11-12,14H,7-8H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | PEMXJEUVKMIRGS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.79 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |