C18H18ClNO — CID 51291710
2-(2-chlorophenyl)-N-(1-phenylethyl)cyclopropane-1-carboxamide (PubChem CID 51291710) has the molecular formula C18H18ClNO and a molecular weight of 299.80 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-(1-phenylethyl)cyclopropane-1-carboxamide.
| Compound Name | 2-(2-chlorophenyl)-N-(1-phenylethyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 51291710 |
| Molecular Formula | C18H18ClNO |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 2-(2-chlorophenyl)-N-(1-phenylethyl)cyclopropane-1-carboxamide |
| SMILES | CC(NC(=O)C1CC1c1ccccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C18H18ClNO/c1-12(13-7-3-2-4-8-13)20-18(21)16-11-15(16)14-9-5-6-10-17(14)19/h2-10,12,15-16H,11H2,1H3,(H,20,21) |
| InChIKey | BLEHAUWUIYNJIF-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |