C17H20N4O3 — CID 124693975
(3R)-3-[[2-(4-cyclopropyltriazol-1-yl)acetyl]amino]-3-(2-methylphenyl)propanoic acid (PubChem CID 124693975) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is (3R)-3-[[2-(4-cyclopropyltriazol-1-yl)acetyl]amino]-3-(2-methylphenyl)propanoic acid.
| Compound Name | (3R)-3-[[2-(4-cyclopropyltriazol-1-yl)acetyl]amino]-3-(2-methylphenyl)propanoic acid |
|---|---|
| PubChem CID | 124693975 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | (3R)-3-[[2-(4-cyclopropyltriazol-1-yl)acetyl]amino]-3-(2-methylphenyl)propanoic acid |
| SMILES | Cc1ccccc1[C@@H](CC(=O)O)NC(=O)Cn1cc(C2CC2)nn1 |
| InChI | InChI=1S/C17H20N4O3/c1-11-4-2-3-5-13(11)14(8-17(23)24)18-16(22)10-21-9-15(19-20-21)12-6-7-12/h2-5,9,12,14H,6-8,10H2,1H3,(H,18,22)(H,23,24)/t14-/m1/s1 |
| InChIKey | XASKGFQHINULDF-CQSZACIVSA-N |
| XLogP | 1.80 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |