C19H23N3O4 — CID 124697276
3-[[1-(2-methylphenyl)pyrazole-4-carbonyl]-[[(2S)-oxolan-2-yl]methyl]amino]propanoic acid (PubChem CID 124697276) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is 3-[[1-(2-methylphenyl)pyrazole-4-carbonyl]-[[(2S)-oxolan-2-yl]methyl]amino]propanoic acid.
| Compound Name | 3-[[1-(2-methylphenyl)pyrazole-4-carbonyl]-[[(2S)-oxolan-2-yl]methyl]amino]propanoic acid |
|---|---|
| PubChem CID | 124697276 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 3-[[1-(2-methylphenyl)pyrazole-4-carbonyl]-[[(2S)-oxolan-2-yl]methyl]amino]propanoic acid |
| SMILES | Cc1ccccc1-n1cc(C(=O)N(CCC(=O)O)C[C@@H]2CCCO2)cn1 |
| InChI | InChI=1S/C19H23N3O4/c1-14-5-2-3-7-17(14)22-12-15(11-20-22)19(25)21(9-8-18(23)24)13-16-6-4-10-26-16/h2-3,5,7,11-12,16H,4,6,8-10,13H2,1H3,(H,23,24)/t16-/m0/s1 |
| InChIKey | YSRNZURVVBIFTR-INIZCTEOSA-N |
| XLogP | 2.28 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |