C20H25N3O5 — CID 125152276
3-[(4-ethoxy-1-phenylpyrazole-3-carbonyl)-[[(2R)-oxolan-2-yl]methyl]amino]propanoic acid (PubChem CID 125152276) has the molecular formula C20H25N3O5 and a molecular weight of 387.44 g/mol. Its IUPAC name is 3-[(4-ethoxy-1-phenylpyrazole-3-carbonyl)-[[(2R)-oxolan-2-yl]methyl]amino]propanoic acid.
| Compound Name | 3-[(4-ethoxy-1-phenylpyrazole-3-carbonyl)-[[(2R)-oxolan-2-yl]methyl]amino]propanoic acid |
|---|---|
| PubChem CID | 125152276 |
| Molecular Formula | C20H25N3O5 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 3-[(4-ethoxy-1-phenylpyrazole-3-carbonyl)-[[(2R)-oxolan-2-yl]methyl]amino]propanoic acid |
| SMILES | CCOc1cn(-c2ccccc2)nc1C(=O)N(CCC(=O)O)C[C@H]1CCCO1 |
| InChI | InChI=1S/C20H25N3O5/c1-2-27-17-14-23(15-7-4-3-5-8-15)21-19(17)20(26)22(11-10-18(24)25)13-16-9-6-12-28-16/h3-5,7-8,14,16H,2,6,9-13H2,1H3,(H,24,25)/t16-/m1/s1 |
| InChIKey | NUCILHUJOIPPEO-MRXNPFEDSA-N |
| XLogP | 2.37 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |