C16H19F3N2O4 — CID 124701589
3-[(3R)-1-[2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetyl]piperidin-3-yl]propanoic acid (PubChem CID 124701589) has the molecular formula C16H19F3N2O4 and a molecular weight of 360.33 g/mol. Its IUPAC name is 3-[(3R)-1-[2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetyl]piperidin-3-yl]propanoic acid.
| Compound Name | 3-[(3R)-1-[2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetyl]piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 124701589 |
| Molecular Formula | C16H19F3N2O4 |
| Molecular Weight | 360.33 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 3-[(3R)-1-[2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetyl]piperidin-3-yl]propanoic acid |
| SMILES | O=C(O)CC[C@H]1CCCN(C(=O)Cn2cccc(C(F)(F)F)c2=O)C1 |
| InChI | InChI=1S/C16H19F3N2O4/c17-16(18,19)12-4-2-8-21(15(12)25)10-13(22)20-7-1-3-11(9-20)5-6-14(23)24/h2,4,8,11H,1,3,5-7,9-10H2,(H,23,24)/t11-/m1/s1 |
| InChIKey | CFICZXFPQHKXKD-LLVKDONJSA-N |
| XLogP | 1.97 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.33 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |