C14H15F3N2O4 — CID 167827145
1-[2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetyl]piperidine-3-carboxylic acid (PubChem CID 167827145) has the molecular formula C14H15F3N2O4 and a molecular weight of 332.28 g/mol. Its IUPAC name is 1-[2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 167827145 |
| Molecular Formula | C14H15F3N2O4 |
| Molecular Weight | 332.28 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 1-[2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(C(=O)Cn2cccc(C(F)(F)F)c2=O)C1 |
| InChI | InChI=1S/C14H15F3N2O4/c15-14(16,17)10-4-2-6-19(12(10)21)8-11(20)18-5-1-3-9(7-18)13(22)23/h2,4,6,9H,1,3,5,7-8H2,(H,22,23) |
| InChIKey | MOHCGDHABASIGW-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.28 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |