C17H19FN2O4 — CID 124705140
(2R)-3-(6-fluoro-1H-indol-3-yl)-2-[[2-[(2R)-oxolan-2-yl]acetyl]amino]propanoic acid (PubChem CID 124705140) has the molecular formula C17H19FN2O4 and a molecular weight of 334.35 g/mol. Its IUPAC name is (2R)-3-(6-fluoro-1H-indol-3-yl)-2-[[2-[(2R)-oxolan-2-yl]acetyl]amino]propanoic acid.
| Compound Name | (2R)-3-(6-fluoro-1H-indol-3-yl)-2-[[2-[(2R)-oxolan-2-yl]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 124705140 |
| Molecular Formula | C17H19FN2O4 |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | (2R)-3-(6-fluoro-1H-indol-3-yl)-2-[[2-[(2R)-oxolan-2-yl]acetyl]amino]propanoic acid |
| SMILES | O=C(C[C@H]1CCCO1)N[C@H](Cc1c[nH]c2cc(F)ccc12)C(=O)O |
| InChI | InChI=1S/C17H19FN2O4/c18-11-3-4-13-10(9-19-14(13)7-11)6-15(17(22)23)20-16(21)8-12-2-1-5-24-12/h3-4,7,9,12,15,19H,1-2,5-6,8H2,(H,20,21)(H,22,23)/t12-,15-/m1/s1 |
| InChIKey | BCYPVTDZSBEAAU-IUODEOHRSA-N |
| XLogP | 1.99 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |