C16H17FN2O4 — CID 124705169
(2R)-3-(6-fluoro-1H-indol-3-yl)-2-[[(2R)-oxolane-2-carbonyl]amino]propanoic acid (PubChem CID 124705169) has the molecular formula C16H17FN2O4 and a molecular weight of 320.32 g/mol. Its IUPAC name is (2R)-3-(6-fluoro-1H-indol-3-yl)-2-[[(2R)-oxolane-2-carbonyl]amino]propanoic acid.
| Compound Name | (2R)-3-(6-fluoro-1H-indol-3-yl)-2-[[(2R)-oxolane-2-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 124705169 |
| Molecular Formula | C16H17FN2O4 |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | (2R)-3-(6-fluoro-1H-indol-3-yl)-2-[[(2R)-oxolane-2-carbonyl]amino]propanoic acid |
| SMILES | O=C(O)[C@@H](Cc1c[nH]c2cc(F)ccc12)NC(=O)[C@H]1CCCO1 |
| InChI | InChI=1S/C16H17FN2O4/c17-10-3-4-11-9(8-18-12(11)7-10)6-13(16(21)22)19-15(20)14-2-1-5-23-14/h3-4,7-8,13-14,18H,1-2,5-6H2,(H,19,20)(H,21,22)/t13-,14-/m1/s1 |
| InChIKey | UNLHOFVJBVXSJH-ZIAGYGMSSA-N |
| XLogP | 1.60 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |