C14H21NO — CID 124705823
(1S,2R)-N-methyl-1-[(2S)-oxolan-2-yl]-2-phenylpropan-1-amine (PubChem CID 124705823) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is (1S,2R)-N-methyl-1-[(2S)-oxolan-2-yl]-2-phenylpropan-1-amine.
| Compound Name | (1S,2R)-N-methyl-1-[(2S)-oxolan-2-yl]-2-phenylpropan-1-amine |
|---|---|
| PubChem CID | 124705823 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | (1S,2R)-N-methyl-1-[(2S)-oxolan-2-yl]-2-phenylpropan-1-amine |
| SMILES | CN[C@H]([C@@H]1CCCO1)[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C14H21NO/c1-11(12-7-4-3-5-8-12)14(15-2)13-9-6-10-16-13/h3-5,7-8,11,13-15H,6,9-10H2,1-2H3/t11-,13+,14+/m1/s1 |
| InChIKey | GQAZOAFCERSYDH-XBFCOCLRSA-N |
| XLogP | 2.56 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |