C6H12BrNO — CID 124709001
[(3R,4R)-3-bromooxan-4-yl]methanamine (PubChem CID 124709001) has the molecular formula C6H12BrNO and a molecular weight of 194.07 g/mol. Its IUPAC name is [(3R,4R)-3-bromooxan-4-yl]methanamine.
| Compound Name | [(3R,4R)-3-bromooxan-4-yl]methanamine |
|---|---|
| PubChem CID | 124709001 |
| Molecular Formula | C6H12BrNO |
| Molecular Weight | 194.07 g/mol |
| Exact Mass | 193.01 |
| IUPAC Name | [(3R,4R)-3-bromooxan-4-yl]methanamine |
| SMILES | NC[C@H]1CCOC[C@@H]1Br |
| InChI | InChI=1S/C6H12BrNO/c7-6-4-9-2-1-5(6)3-8/h5-6H,1-4,8H2/t5-,6+/m1/s1 |
| InChIKey | FSVNRJSUFNTIKR-RITPCOANSA-N |
| XLogP | 0.75 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.07 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|