C12H25NO — CID 124710122
(4R)-4-[[(1S,2R)-2-methylcyclohexyl]amino]pentan-1-ol (PubChem CID 124710122) has the molecular formula C12H25NO and a molecular weight of 199.34 g/mol. Its IUPAC name is (4R)-4-[[(1S,2R)-2-methylcyclohexyl]amino]pentan-1-ol.
| Compound Name | (4R)-4-[[(1S,2R)-2-methylcyclohexyl]amino]pentan-1-ol |
|---|---|
| PubChem CID | 124710122 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | (4R)-4-[[(1S,2R)-2-methylcyclohexyl]amino]pentan-1-ol |
| SMILES | C[C@H](CCCO)N[C@H]1CCCC[C@H]1C |
| InChI | InChI=1S/C12H25NO/c1-10-6-3-4-8-12(10)13-11(2)7-5-9-14/h10-14H,3-9H2,1-2H3/t10-,11-,12+/m1/s1 |
| InChIKey | SGFNAQCPGDDHSM-UTUOFQBUSA-N |
| XLogP | 2.32 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |