C10H21NO2 — CID 96980097
2-[[(1S,2R)-2-methylcyclohexyl]amino]propane-1,3-diol (PubChem CID 96980097) has the molecular formula C10H21NO2 and a molecular weight of 187.28 g/mol. Its IUPAC name is 2-[[(1S,2R)-2-methylcyclohexyl]amino]propane-1,3-diol.
| Compound Name | 2-[[(1S,2R)-2-methylcyclohexyl]amino]propane-1,3-diol |
|---|---|
| PubChem CID | 96980097 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | 2-[[(1S,2R)-2-methylcyclohexyl]amino]propane-1,3-diol |
| SMILES | C[C@@H]1CCCC[C@@H]1NC(CO)CO |
| InChI | InChI=1S/C10H21NO2/c1-8-4-2-3-5-10(8)11-9(6-12)7-13/h8-13H,2-7H2,1H3/t8-,10+/m1/s1 |
| InChIKey | VGPZEEKOHLASGZ-SCZZXKLOSA-N |
| XLogP | 0.51 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |