About 2-[[(1R,2R)-2-ethylcyclohexyl]amino]propane-1,3-diol
2-[[(1R,2R)-2-ethylcyclohexyl]amino]propane-1,3-diol (PubChem CID 96980456) has the molecular formula C11H23NO2
and a molecular weight of 201.31 g/mol. Its IUPAC name is 2-[[(1R,2R)-2-ethylcyclohexyl]amino]propane-1,3-diol.
Molecular Properties
| Compound Name | 2-[[(1R,2R)-2-ethylcyclohexyl]amino]propane-1,3-diol |
| PubChem CID | 96980456 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | 2-[[(1R,2R)-2-ethylcyclohexyl]amino]propane-1,3-diol |
| SMILES | CC[C@@H]1CCCC[C@H]1NC(CO)CO |
| InChI | InChI=1S/C11H23NO2/c1-2-9-5-3-4-6-11(9)12-10(7-13)8-14/h9-14H,2-8H2,1H3/t9-,11-/m1/s1 |
| InChIKey | MBKDPFWDEKGFCY-MWLCHTKSSA-N |
| XLogP | 0.90 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[[(1R,2R)-2-ethylcyclohexyl]amino]propane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(1R,2R)-2-ethylcyclohexyl]amino]propane-1,3-diol?
The IUPAC name of 2-[[(1R,2R)-2-ethylcyclohexyl]amino]propane-1,3-diol (CID 96980456) is 2-[[(1R,2R)-2-ethylcyclohexyl]amino]propane-1,3-diol.
What is the SMILES notation for 2-[[(1R,2R)-2-ethylcyclohexyl]amino]propane-1,3-diol?
The canonical SMILES for 2-[[(1R,2R)-2-ethylcyclohexyl]amino]propane-1,3-diol is CC[C@@H]1CCCC[C@H]1NC(CO)CO.
What is the InChIKey of 2-[[(1R,2R)-2-ethylcyclohexyl]amino]propane-1,3-diol?
The InChIKey is MBKDPFWDEKGFCY-MWLCHTKSSA-N. The full InChI is InChI=1S/C11H23NO2/c1-2-9-5-3-4-6-11(9)12-10(7-13)8-14/h9-14H,2-8H2,1H3/t9-,11-/m1/s1.
What are the key properties of 2-[[(1R,2R)-2-ethylcyclohexyl]amino]propane-1,3-diol?
2-[[(1R,2R)-2-ethylcyclohexyl]amino]propane-1,3-diol has a molecular weight of 201.31 g/mol, XLogP of 0.90, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(1R,2R)-2-ethylcyclohexyl]amino]propane-1,3-diol is sourced from PubChem (CID 96980456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).