C12H25NO2 — CID 115883514
2-[(2-ethyl-4-methylcyclohexyl)amino]propane-1,3-diol (PubChem CID 115883514) has the molecular formula C12H25NO2 and a molecular weight of 215.34 g/mol. Its IUPAC name is 2-[(2-ethyl-4-methylcyclohexyl)amino]propane-1,3-diol.
| Compound Name | 2-[(2-ethyl-4-methylcyclohexyl)amino]propane-1,3-diol |
|---|---|
| PubChem CID | 115883514 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | 2-[(2-ethyl-4-methylcyclohexyl)amino]propane-1,3-diol |
| SMILES | CCC1CC(C)CCC1NC(CO)CO |
| InChI | InChI=1S/C12H25NO2/c1-3-10-6-9(2)4-5-12(10)13-11(7-14)8-15/h9-15H,3-8H2,1-2H3 |
| InChIKey | IAVBRNLNMJVHKH-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |