C11H21F2N — CID 102868581
N-(1,1-difluoropropan-2-yl)-2-ethylcyclohexan-1-amine (PubChem CID 102868581) has the molecular formula C11H21F2N and a molecular weight of 205.29 g/mol. Its IUPAC name is N-(1,1-difluoropropan-2-yl)-2-ethylcyclohexan-1-amine.
| Compound Name | N-(1,1-difluoropropan-2-yl)-2-ethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 102868581 |
| Molecular Formula | C11H21F2N |
| Molecular Weight | 205.29 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | N-(1,1-difluoropropan-2-yl)-2-ethylcyclohexan-1-amine |
| SMILES | CCC1CCCCC1NC(C)C(F)F |
| InChI | InChI=1S/C11H21F2N/c1-3-9-6-4-5-7-10(9)14-8(2)11(12)13/h8-11,14H,3-7H2,1-2H3 |
| InChIKey | UEXBJZIRLLLLEQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.29 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |