C15H29NO2 — CID 65313032
2-[(2-cyclohexylcyclohexyl)amino]propane-1,3-diol (PubChem CID 65313032) has the molecular formula C15H29NO2 and a molecular weight of 255.40 g/mol. Its IUPAC name is 2-[(2-cyclohexylcyclohexyl)amino]propane-1,3-diol.
| Compound Name | 2-[(2-cyclohexylcyclohexyl)amino]propane-1,3-diol |
|---|---|
| PubChem CID | 65313032 |
| Molecular Formula | C15H29NO2 |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.22 |
| IUPAC Name | 2-[(2-cyclohexylcyclohexyl)amino]propane-1,3-diol |
| SMILES | OCC(CO)NC1CCCCC1C1CCCCC1 |
| InChI | InChI=1S/C15H29NO2/c17-10-13(11-18)16-15-9-5-4-8-14(15)12-6-2-1-3-7-12/h12-18H,1-11H2 |
| InChIKey | TURJAKKIIBINDX-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |