C14H14N2O3 — CID 124710219
(2S,3R)-2-(1-phenylimidazol-2-yl)oxolane-3-carboxylic acid (PubChem CID 124710219) has the molecular formula C14H14N2O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is (2S,3R)-2-(1-phenylimidazol-2-yl)oxolane-3-carboxylic acid.
| Compound Name | (2S,3R)-2-(1-phenylimidazol-2-yl)oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 124710219 |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | (2S,3R)-2-(1-phenylimidazol-2-yl)oxolane-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCO[C@@H]1c1nccn1-c1ccccc1 |
| InChI | InChI=1S/C14H14N2O3/c17-14(18)11-6-9-19-12(11)13-15-7-8-16(13)10-4-2-1-3-5-10/h1-5,7-8,11-12H,6,9H2,(H,17,18)/t11-,12+/m1/s1 |
| InChIKey | TTZOSKADNJZIGW-NEPJUHHUSA-N |
| XLogP | 2.03 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |