C19H23N3O3 — CID 122132981
N-[(2S,3S)-2-(1-phenylimidazol-2-yl)oxolan-3-yl]oxane-3-carboxamide (PubChem CID 122132981) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is N-[(2S,3S)-2-(1-phenylimidazol-2-yl)oxolan-3-yl]oxane-3-carboxamide.
| Compound Name | N-[(2S,3S)-2-(1-phenylimidazol-2-yl)oxolan-3-yl]oxane-3-carboxamide |
|---|---|
| PubChem CID | 122132981 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | N-[(2S,3S)-2-(1-phenylimidazol-2-yl)oxolan-3-yl]oxane-3-carboxamide |
| SMILES | O=C(N[C@H]1CCO[C@@H]1c1nccn1-c1ccccc1)C1CCCOC1 |
| InChI | InChI=1S/C19H23N3O3/c23-19(14-5-4-11-24-13-14)21-16-8-12-25-17(16)18-20-9-10-22(18)15-6-2-1-3-7-15/h1-3,6-7,9-10,14,16-17H,4-5,8,11-13H2,(H,21,23)/t14?,16-,17-/m0/s1 |
| InChIKey | YHHZNPXSLROYMX-HGVHAKBWSA-N |
| XLogP | 2.25 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |