C19H23NO4 — CID 124711048
(1R,2S,3R,6R,8S,9R,10R)-5-(4-ethoxyphenyl)-6-ethyl-9-hydroxy-7-oxa-5-azatetracyclo[6.3.0.02,6.03,10]undecan-4-one (PubChem CID 124711048) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is (1R,2S,3R,6R,8S,9R,10R)-5-(4-ethoxyphenyl)-6-ethyl-9-hydroxy-7-oxa-5-azatetracyclo[6.3.0.02,6.03,10]undecan-4-one.
| Compound Name | (1R,2S,3R,6R,8S,9R,10R)-5-(4-ethoxyphenyl)-6-ethyl-9-hydroxy-7-oxa-5-azatetracyclo[6.3.0.02,6.03,10]undecan-4-one |
|---|---|
| PubChem CID | 124711048 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | (1R,2S,3R,6R,8S,9R,10R)-5-(4-ethoxyphenyl)-6-ethyl-9-hydroxy-7-oxa-5-azatetracyclo[6.3.0.02,6.03,10]undecan-4-one |
| SMILES | CCOc1ccc(N2C(=O)[C@@H]3[C@H]4C[C@H]5[C@H](O[C@]2(CC)[C@@H]53)[C@@H]4O)cc1 |
| InChI | InChI=1S/C19H23NO4/c1-3-19-15-13-9-12(16(21)17(13)24-19)14(15)18(22)20(19)10-5-7-11(8-6-10)23-4-2/h5-8,12-17,21H,3-4,9H2,1-2H3/t12-,13-,14-,15+,16-,17+,19-/m1/s1 |
| InChIKey | CXKUEDORVXONBW-BPEFDQORSA-N |
| XLogP | 2.18 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |