C17H17F2NO4 — CID 124714467
(1R,2R,3R,4R)-3-[[4-(difluoromethoxy)phenyl]carbamoyl]bicyclo[2.2.2]oct-5-ene-2-carboxylic acid (PubChem CID 124714467) has the molecular formula C17H17F2NO4 and a molecular weight of 337.32 g/mol. Its IUPAC name is (1R,2R,3R,4R)-3-[[4-(difluoromethoxy)phenyl]carbamoyl]bicyclo[2.2.2]oct-5-ene-2-carboxylic acid.
| Compound Name | (1R,2R,3R,4R)-3-[[4-(difluoromethoxy)phenyl]carbamoyl]bicyclo[2.2.2]oct-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 124714467 |
| Molecular Formula | C17H17F2NO4 |
| Molecular Weight | 337.32 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | (1R,2R,3R,4R)-3-[[4-(difluoromethoxy)phenyl]carbamoyl]bicyclo[2.2.2]oct-5-ene-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1[C@H](C(=O)Nc2ccc(OC(F)F)cc2)[C@H]2C=C[C@H]1CC2 |
| InChI | InChI=1S/C17H17F2NO4/c18-17(19)24-12-7-5-11(6-8-12)20-15(21)13-9-1-3-10(4-2-9)14(13)16(22)23/h1,3,5-10,13-14,17H,2,4H2,(H,20,21)(H,22,23)/t9-,10-,13+,14+/m0/s1 |
| InChIKey | KZTMETJQRIIVRY-DUBDDPSESA-N |
| XLogP | 3.14 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.32 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|