C23H28BrNO3 — CID 124718817
[2-oxo-2-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl] (5R,7R)-3-bromoadamantane-1-carboxylate (PubChem CID 124718817) has the molecular formula C23H28BrNO3 and a molecular weight of 446.39 g/mol. Its IUPAC name is [2-oxo-2-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl] (5R,7R)-3-bromoadamantane-1-carboxylate.
| Compound Name | [2-oxo-2-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl] (5R,7R)-3-bromoadamantane-1-carboxylate |
|---|---|
| PubChem CID | 124718817 |
| Molecular Formula | C23H28BrNO3 |
| Molecular Weight | 446.39 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | [2-oxo-2-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl] (5R,7R)-3-bromoadamantane-1-carboxylate |
| SMILES | O=C(COC(=O)C12C[C@H]3C[C@@H](CC(Br)(C3)C1)C2)N[C@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C23H28BrNO3/c24-23-11-15-8-16(12-23)10-22(9-15,14-23)21(27)28-13-20(26)25-19-7-3-5-17-4-1-2-6-18(17)19/h1-2,4,6,15-16,19H,3,5,7-14H2,(H,25,26)/t15-,16-,19+,22?,23?/m1/s1 |
| InChIKey | DVLDUQMWGKYIHO-QGGDEUQGSA-N |
| XLogP | 4.46 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.39 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|