C28H28NO4P — CID 23988314
[2-oxo-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)ethyl] 1-diphenylphosphorylcyclopropane-1-carboxylate (PubChem CID 23988314) has the molecular formula C28H28NO4P and a molecular weight of 473.51 g/mol. Its IUPAC name is [2-oxo-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)ethyl] 1-diphenylphosphorylcyclopropane-1-carboxylate.
| Compound Name | [2-oxo-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)ethyl] 1-diphenylphosphorylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 23988314 |
| Molecular Formula | C28H28NO4P |
| Molecular Weight | 473.51 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | [2-oxo-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)ethyl] 1-diphenylphosphorylcyclopropane-1-carboxylate |
| SMILES | O=C(COC(=O)C1(P(=O)(c2ccccc2)c2ccccc2)CC1)NC1CCCc2ccccc21 |
| InChI | InChI=1S/C28H28NO4P/c30-26(29-25-17-9-11-21-10-7-8-16-24(21)25)20-33-27(31)28(18-19-28)34(32,22-12-3-1-4-13-22)23-14-5-2-6-15-23/h1-8,10,12-16,25H,9,11,17-20H2,(H,29,30) |
| InChIKey | YHTQLVZPCMYXKO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.51 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|