C22H21F3N2O3 — CID 124721124
N-[[(1S,2S,6R,7S,8R,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]methyl]-N-(2-ethylphenyl)-2,2,2-trifluoroacetamide (PubChem CID 124721124) has the molecular formula C22H21F3N2O3 and a molecular weight of 418.42 g/mol. Its IUPAC name is N-[[(1S,2S,6R,7S,8R,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]methyl]-N-(2-ethylphenyl)-2,2,2-trifluoroacetamide.
| Compound Name | N-[[(1S,2S,6R,7S,8R,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]methyl]-N-(2-ethylphenyl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 124721124 |
| Molecular Formula | C22H21F3N2O3 |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | N-[[(1S,2S,6R,7S,8R,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]methyl]-N-(2-ethylphenyl)-2,2,2-trifluoroacetamide |
| SMILES | CCc1ccccc1N(CN1C(=O)[C@@H]2[C@H]3C=C[C@@H]([C@@H]4C[C@@H]34)[C@@H]2C1=O)C(=O)C(F)(F)F |
| InChI | InChI=1S/C22H21F3N2O3/c1-2-11-5-3-4-6-16(11)26(21(30)22(23,24)25)10-27-19(28)17-12-7-8-13(15-9-14(12)15)18(17)20(27)29/h3-8,12-15,17-18H,2,9-10H2,1H3/t12-,13-,14-,15-,17-,18+/m0/s1 |
| InChIKey | MRYOEHRLOWYCCK-OZINRZGZSA-N |
| XLogP | 3.15 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|