C17H17N3O5S — CID 1247216
N-cyclopropyl-2-[[2-(3-methyl-4-nitrophenoxy)acetyl]amino]thiophene-3-carboxamide (PubChem CID 1247216) has the molecular formula C17H17N3O5S and a molecular weight of 375.41 g/mol. Its IUPAC name is N-cyclopropyl-2-[[2-(3-methyl-4-nitrophenoxy)acetyl]amino]thiophene-3-carboxamide.
| Compound Name | N-cyclopropyl-2-[[2-(3-methyl-4-nitrophenoxy)acetyl]amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 1247216 |
| Molecular Formula | C17H17N3O5S |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | N-cyclopropyl-2-[[2-(3-methyl-4-nitrophenoxy)acetyl]amino]thiophene-3-carboxamide |
| SMILES | Cc1cc(OCC(=O)Nc2sccc2C(=O)NC2CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H17N3O5S/c1-10-8-12(4-5-14(10)20(23)24)25-9-15(21)19-17-13(6-7-26-17)16(22)18-11-2-3-11/h4-8,11H,2-3,9H2,1H3,(H,18,22)(H,19,21) |
| InChIKey | KOOOZEGQBOXGKD-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|