C17H18N2O3S — CID 60590871
N-cyclopropyl-2-[(3-methoxy-4-methylbenzoyl)amino]thiophene-3-carboxamide (PubChem CID 60590871) has the molecular formula C17H18N2O3S and a molecular weight of 330.41 g/mol. Its IUPAC name is N-cyclopropyl-2-[(3-methoxy-4-methylbenzoyl)amino]thiophene-3-carboxamide.
| Compound Name | N-cyclopropyl-2-[(3-methoxy-4-methylbenzoyl)amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 60590871 |
| Molecular Formula | C17H18N2O3S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | N-cyclopropyl-2-[(3-methoxy-4-methylbenzoyl)amino]thiophene-3-carboxamide |
| SMILES | COc1cc(C(=O)Nc2sccc2C(=O)NC2CC2)ccc1C |
| InChI | InChI=1S/C17H18N2O3S/c1-10-3-4-11(9-14(10)22-2)15(20)19-17-13(7-8-23-17)16(21)18-12-5-6-12/h3-4,7-9,12H,5-6H2,1-2H3,(H,18,21)(H,19,20) |
| InChIKey | TYPNFYJHXPVAIM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |