C21H26N2O3S — CID 60587824
N-(4-hydroxycyclohexyl)-2-[(4-propan-2-ylbenzoyl)amino]thiophene-3-carboxamide (PubChem CID 60587824) has the molecular formula C21H26N2O3S and a molecular weight of 386.52 g/mol. Its IUPAC name is N-(4-hydroxycyclohexyl)-2-[(4-propan-2-ylbenzoyl)amino]thiophene-3-carboxamide.
| Compound Name | N-(4-hydroxycyclohexyl)-2-[(4-propan-2-ylbenzoyl)amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 60587824 |
| Molecular Formula | C21H26N2O3S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | N-(4-hydroxycyclohexyl)-2-[(4-propan-2-ylbenzoyl)amino]thiophene-3-carboxamide |
| SMILES | CC(C)c1ccc(C(=O)Nc2sccc2C(=O)NC2CCC(O)CC2)cc1 |
| InChI | InChI=1S/C21H26N2O3S/c1-13(2)14-3-5-15(6-4-14)19(25)23-21-18(11-12-27-21)20(26)22-16-7-9-17(24)10-8-16/h3-6,11-13,16-17,24H,7-10H2,1-2H3,(H,22,26)(H,23,25) |
| InChIKey | JMXCKWZPMMWRRV-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |