C23H32N2O5S — CID 86820089
N-[2-(2,2-diethoxyethoxy)ethyl]-2-[(4-propan-2-ylbenzoyl)amino]thiophene-3-carboxamide (PubChem CID 86820089) has the molecular formula C23H32N2O5S and a molecular weight of 448.59 g/mol. Its IUPAC name is N-[2-(2,2-diethoxyethoxy)ethyl]-2-[(4-propan-2-ylbenzoyl)amino]thiophene-3-carboxamide.
| Compound Name | N-[2-(2,2-diethoxyethoxy)ethyl]-2-[(4-propan-2-ylbenzoyl)amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 86820089 |
| Molecular Formula | C23H32N2O5S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | N-[2-(2,2-diethoxyethoxy)ethyl]-2-[(4-propan-2-ylbenzoyl)amino]thiophene-3-carboxamide |
| SMILES | CCOC(COCCNC(=O)c1ccsc1NC(=O)c1ccc(C(C)C)cc1)OCC |
| InChI | InChI=1S/C23H32N2O5S/c1-5-29-20(30-6-2)15-28-13-12-24-22(27)19-11-14-31-23(19)25-21(26)18-9-7-17(8-10-18)16(3)4/h7-11,14,16,20H,5-6,12-13,15H2,1-4H3,(H,24,27)(H,25,26) |
| InChIKey | ZLEDUXCBJIXLNR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|