C13H17N3O4S — CID 71936867
methyl N-[2-[[3-(cyclopropylcarbamoyl)thiophen-2-yl]amino]-2-oxoethyl]-N-methylcarbamate (PubChem CID 71936867) has the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. Its IUPAC name is methyl N-[2-[[3-(cyclopropylcarbamoyl)thiophen-2-yl]amino]-2-oxoethyl]-N-methylcarbamate.
| Compound Name | methyl N-[2-[[3-(cyclopropylcarbamoyl)thiophen-2-yl]amino]-2-oxoethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 71936867 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | methyl N-[2-[[3-(cyclopropylcarbamoyl)thiophen-2-yl]amino]-2-oxoethyl]-N-methylcarbamate |
| SMILES | COC(=O)N(C)CC(=O)Nc1sccc1C(=O)NC1CC1 |
| InChI | InChI=1S/C13H17N3O4S/c1-16(13(19)20-2)7-10(17)15-12-9(5-6-21-12)11(18)14-8-3-4-8/h5-6,8H,3-4,7H2,1-2H3,(H,14,18)(H,15,17) |
| InChIKey | SHUSJJKZAKFGJT-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |