C16H22F3N3O2 — CID 124721646
1-[(2R,3S)-1-ethyl-2-(3,4,5-trifluorophenyl)pyrrolidin-3-yl]-3-[(2S)-1-hydroxypropan-2-yl]urea (PubChem CID 124721646) has the molecular formula C16H22F3N3O2 and a molecular weight of 345.37 g/mol. Its IUPAC name is 1-[(2R,3S)-1-ethyl-2-(3,4,5-trifluorophenyl)pyrrolidin-3-yl]-3-[(2S)-1-hydroxypropan-2-yl]urea.
| Compound Name | 1-[(2R,3S)-1-ethyl-2-(3,4,5-trifluorophenyl)pyrrolidin-3-yl]-3-[(2S)-1-hydroxypropan-2-yl]urea |
|---|---|
| PubChem CID | 124721646 |
| Molecular Formula | C16H22F3N3O2 |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 1-[(2R,3S)-1-ethyl-2-(3,4,5-trifluorophenyl)pyrrolidin-3-yl]-3-[(2S)-1-hydroxypropan-2-yl]urea |
| SMILES | CCN1CC[C@H](NC(=O)N[C@@H](C)CO)[C@H]1c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C16H22F3N3O2/c1-3-22-5-4-13(21-16(24)20-9(2)8-23)15(22)10-6-11(17)14(19)12(18)7-10/h6-7,9,13,15,23H,3-5,8H2,1-2H3,(H2,20,21,24)/t9-,13-,15+/m0/s1 |
| InChIKey | AGPGUPQYNOXKRE-DYQSUWPFSA-N |
| XLogP | 1.92 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|