C17H27N5O2 — CID 124721716
(3R)-N-[(3S)-1-(6-ethylpyrimidin-4-yl)piperidin-3-yl]-3-methylmorpholine-4-carboxamide (PubChem CID 124721716) has the molecular formula C17H27N5O2 and a molecular weight of 333.44 g/mol. Its IUPAC name is (3R)-N-[(3S)-1-(6-ethylpyrimidin-4-yl)piperidin-3-yl]-3-methylmorpholine-4-carboxamide.
| Compound Name | (3R)-N-[(3S)-1-(6-ethylpyrimidin-4-yl)piperidin-3-yl]-3-methylmorpholine-4-carboxamide |
|---|---|
| PubChem CID | 124721716 |
| Molecular Formula | C17H27N5O2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | (3R)-N-[(3S)-1-(6-ethylpyrimidin-4-yl)piperidin-3-yl]-3-methylmorpholine-4-carboxamide |
| SMILES | CCc1cc(N2CCC[C@H](NC(=O)N3CCOC[C@H]3C)C2)ncn1 |
| InChI | InChI=1S/C17H27N5O2/c1-3-14-9-16(19-12-18-14)21-6-4-5-15(10-21)20-17(23)22-7-8-24-11-13(22)2/h9,12-13,15H,3-8,10-11H2,1-2H3,(H,20,23)/t13-,15+/m1/s1 |
| InChIKey | AHPHSPFWRGGLRH-HIFRSBDPSA-N |
| XLogP | 1.44 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |