C16H31NO3S — CID 124726331
trans-(1R,2R)-2-[3-[[(1S,2R)-2-methylsulfonylcyclohexyl]amino]propyl]cyclohexan-1-ol (PubChem CID 124726331) has the molecular formula C16H31NO3S and a molecular weight of 317.50 g/mol. Its IUPAC name is trans-(1R,2R)-2-[3-[[(1S,2R)-2-methylsulfonylcyclohexyl]amino]propyl]cyclohexan-1-ol.
| Compound Name | trans-(1R,2R)-2-[3-[[(1S,2R)-2-methylsulfonylcyclohexyl]amino]propyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 124726331 |
| Molecular Formula | C16H31NO3S |
| Molecular Weight | 317.50 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | trans-(1R,2R)-2-[3-[[(1S,2R)-2-methylsulfonylcyclohexyl]amino]propyl]cyclohexan-1-ol |
| SMILES | CS(=O)(=O)[C@@H]1CCCC[C@@H]1NCCC[C@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C16H31NO3S/c1-21(19,20)16-11-5-3-9-14(16)17-12-6-8-13-7-2-4-10-15(13)18/h13-18H,2-12H2,1H3/t13-,14+,15-,16-/m1/s1 |
| InChIKey | BTVGVFKDVMJOPR-QKPAOTATSA-N |
| XLogP | 2.26 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.50 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|