C18H24N4O3 — CID 124726680
trans-(1R,2R)-2-[methyl-[[5-methyl-4-(3-nitrophenyl)-1H-imidazol-2-yl]methyl]amino]cyclohexan-1-ol (PubChem CID 124726680) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is trans-(1R,2R)-2-[methyl-[[5-methyl-4-(3-nitrophenyl)-1H-imidazol-2-yl]methyl]amino]cyclohexan-1-ol.
| Compound Name | trans-(1R,2R)-2-[methyl-[[5-methyl-4-(3-nitrophenyl)-1H-imidazol-2-yl]methyl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 124726680 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | trans-(1R,2R)-2-[methyl-[[5-methyl-4-(3-nitrophenyl)-1H-imidazol-2-yl]methyl]amino]cyclohexan-1-ol |
| SMILES | Cc1[nH]c(CN(C)[C@@H]2CCCC[C@H]2O)nc1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H24N4O3/c1-12-18(13-6-5-7-14(10-13)22(24)25)20-17(19-12)11-21(2)15-8-3-4-9-16(15)23/h5-7,10,15-16,23H,3-4,8-9,11H2,1-2H3,(H,19,20)/t15-,16-/m1/s1 |
| InChIKey | CILABTHQFNHAID-HZPDHXFCSA-N |
| XLogP | 3.03 |
| TPSA | 95.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|