C22H23N3O5 — CID 124727164
N-[3-[[(2R)-2-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoyl]amino]phenyl]furan-2-carboxamide (PubChem CID 124727164) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is N-[3-[[(2R)-2-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoyl]amino]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[[(2R)-2-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoyl]amino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 124727164 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | N-[3-[[(2R)-2-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoyl]amino]phenyl]furan-2-carboxamide |
| SMILES | C[C@H](C(=O)Nc1cccc(NC(=O)c2ccco2)c1)N1C(=O)[C@@H]2CCCC[C@H]2C1=O |
| InChI | InChI=1S/C22H23N3O5/c1-13(25-21(28)16-8-2-3-9-17(16)22(25)29)19(26)23-14-6-4-7-15(12-14)24-20(27)18-10-5-11-30-18/h4-7,10-13,16-17H,2-3,8-9H2,1H3,(H,23,26)(H,24,27)/t13-,16-,17-/m1/s1 |
| InChIKey | CPCCSNBQINACSN-KBRIMQKVSA-N |
| XLogP | 3.03 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|