C22H28N2O3 — CID 124727341
1-(1-adamantyl)-3-[(2S)-2-(1-benzofuran-2-yl)-2-methoxyethyl]urea (PubChem CID 124727341) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[(2S)-2-(1-benzofuran-2-yl)-2-methoxyethyl]urea.
| Compound Name | 1-(1-adamantyl)-3-[(2S)-2-(1-benzofuran-2-yl)-2-methoxyethyl]urea |
|---|---|
| PubChem CID | 124727341 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 1-(1-adamantyl)-3-[(2S)-2-(1-benzofuran-2-yl)-2-methoxyethyl]urea |
| SMILES | CO[C@@H](CNC(=O)NC12CC3CC(CC(C3)C1)C2)c1cc2ccccc2o1 |
| InChI | InChI=1S/C22H28N2O3/c1-26-20(19-9-17-4-2-3-5-18(17)27-19)13-23-21(25)24-22-10-14-6-15(11-22)8-16(7-14)12-22/h2-5,9,14-16,20H,6-8,10-13H2,1H3,(H2,23,24,25)/t14?,15?,16?,20-,22?/m0/s1 |
| InChIKey | KZFUFLBIAKAMES-KNBKFLTOSA-N |
| XLogP | 4.39 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |