C19H19ClN2O4 — CID 129357962
1-[(2R)-2-(1-benzofuran-2-yl)-2-methoxyethyl]-3-(5-chloro-2-methoxyphenyl)urea (PubChem CID 129357962) has the molecular formula C19H19ClN2O4 and a molecular weight of 374.82 g/mol. Its IUPAC name is 1-[(2R)-2-(1-benzofuran-2-yl)-2-methoxyethyl]-3-(5-chloro-2-methoxyphenyl)urea.
| Compound Name | 1-[(2R)-2-(1-benzofuran-2-yl)-2-methoxyethyl]-3-(5-chloro-2-methoxyphenyl)urea |
|---|---|
| PubChem CID | 129357962 |
| Molecular Formula | C19H19ClN2O4 |
| Molecular Weight | 374.82 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 1-[(2R)-2-(1-benzofuran-2-yl)-2-methoxyethyl]-3-(5-chloro-2-methoxyphenyl)urea |
| SMILES | COc1ccc(Cl)cc1NC(=O)NC[C@@H](OC)c1cc2ccccc2o1 |
| InChI | InChI=1S/C19H19ClN2O4/c1-24-16-8-7-13(20)10-14(16)22-19(23)21-11-18(25-2)17-9-12-5-3-4-6-15(12)26-17/h3-10,18H,11H2,1-2H3,(H2,21,22,23)/t18-/m1/s1 |
| InChIKey | YTGNRCVERQNOBO-GOSISDBHSA-N |
| XLogP | 4.60 |
| TPSA | 72.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.82 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |