C11H13NO4S2 — CID 124727787
N-[(2R)-2-(furan-3-yl)-2-hydroxy-2-thiophen-2-ylethyl]methanesulfonamide (PubChem CID 124727787) has the molecular formula C11H13NO4S2 and a molecular weight of 287.36 g/mol. Its IUPAC name is N-[(2R)-2-(furan-3-yl)-2-hydroxy-2-thiophen-2-ylethyl]methanesulfonamide.
| Compound Name | N-[(2R)-2-(furan-3-yl)-2-hydroxy-2-thiophen-2-ylethyl]methanesulfonamide |
|---|---|
| PubChem CID | 124727787 |
| Molecular Formula | C11H13NO4S2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | N-[(2R)-2-(furan-3-yl)-2-hydroxy-2-thiophen-2-ylethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NC[C@](O)(c1ccoc1)c1cccs1 |
| InChI | InChI=1S/C11H13NO4S2/c1-18(14,15)12-8-11(13,9-4-5-16-7-9)10-3-2-6-17-10/h2-7,12-13H,8H2,1H3/t11-/m0/s1 |
| InChIKey | SHNXAEDCRXNPEV-NSHDSACASA-N |
| XLogP | 1.13 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |