C13H19NO3S — CID 124729091
4-[(2S,6R)-2-methyl-6-thiophen-3-ylmorpholin-4-yl]butanoic acid (PubChem CID 124729091) has the molecular formula C13H19NO3S and a molecular weight of 269.37 g/mol. Its IUPAC name is 4-[(2S,6R)-2-methyl-6-thiophen-3-ylmorpholin-4-yl]butanoic acid.
| Compound Name | 4-[(2S,6R)-2-methyl-6-thiophen-3-ylmorpholin-4-yl]butanoic acid |
|---|---|
| PubChem CID | 124729091 |
| Molecular Formula | C13H19NO3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 4-[(2S,6R)-2-methyl-6-thiophen-3-ylmorpholin-4-yl]butanoic acid |
| SMILES | C[C@H]1CN(CCCC(=O)O)C[C@@H](c2ccsc2)O1 |
| InChI | InChI=1S/C13H19NO3S/c1-10-7-14(5-2-3-13(15)16)8-12(17-10)11-4-6-18-9-11/h4,6,9-10,12H,2-3,5,7-8H2,1H3,(H,15,16)/t10-,12-/m0/s1 |
| InChIKey | FRBGXYYTQFQZQG-JQWIXIFHSA-N |
| XLogP | 2.37 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |